| Name |
N-Caffeoylputrescine |
| Formula |
C13H18N2O3 |
| Mw |
250.13174246 |
| CAS RN |
29554-26-5 |
| C_ID |
C00002719
, 
|
| InChIKey |
KTZNZCYTXQYEHT-GQCTYLIASA-N |
| InChICode |
InChI=1S/C13H18N2O3/c14-7-1-2-8-15-13(18)6-4-10-3-5-11(16)12(17)9-10/h3-6,9,16-17H,1-2,7-8,14H2,(H,15,18)/b6-4+ |
| SMILES |
NCCCCNC(=O)/C=C/c1ccc(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Lys |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Pentaclethra macrophylla  | Ref. |
| Plantae | Lauraceae | Persea gratissima  | Ref. |
| Plantae | Salicaceae | Salix spp. | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Petunia x hybrida | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
|
|
zoom in
| Organism | Capsicum annuum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|