| Name |
Aspidinol |
| Formula |
C12H16O4 |
| Mw |
224.104859 |
| CAS RN |
519-40-4 |
| C_ID |
C00002691
, 
|
| InChIKey |
GJRJTYFSORWKBE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H16O4/c1-4-5-8(13)11-9(14)6-10(16-3)7(2)12(11)15/h6,14-15H,4-5H2,1-3H3 |
| SMILES |
CCCC(=O)c1c(O)cc(OC)c(C)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Dryopteridaceae | Dryopteris austriaca | Ref. |
| Plantae | Dryopteridaceae | Dryopteris crassirhizoma | Ref. |
| Plantae | Dryopteridaceae | Dryopteris filix-mas | Ref. |
| Plantae | Polypodiaceae | Aspidium filix-mas | Ref. |
| Plantae | Woodsiaceae/Dryopteridaceae | Athyrium filix-femina | Ref. |
|
|
zoom in
| Organism | Dryopteris filix-mas |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|
