| Name |
3',5'-Dimethoxy-4'-hydroxyacetophenone Acetosyringone |
| Formula |
C10H12O4 |
| Mw |
196.07355887 |
| CAS RN |
2478-38-8 |
| C_ID |
C00002686
, 
|
| InChIKey |
OJOBTAOGJIWAGB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H12O4/c1-6(11)7-4-8(13-2)10(12)9(5-7)14-3/h4-5,12H,1-3H3 |
| SMILES |
COc1cc(C(C)=O)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Bulbine narcissifolia | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
|
|
zoom in
| Organism | Scrophularia ningpoensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|