| Name |
(R)-4-Methoxydalbergione |
| Formula |
C16H14O3 |
| Mw |
254.09429431 |
| CAS RN |
4646-86-0 |
| C_ID |
C00002549
, 
|
| InChIKey |
RGSUZUQISVAJJF-STGVRZAANA-N |
| InChICode |
InChI=1S/C16H14O3/c1-3-12(11-7-5-4-6-8-11)13-9-15(18)16(19-2)10-14(13)17/h3-10,12H,1H2,2H3/t12-/m1/s1 |
| SMILES |
C=C[C@@H](C1=CC(=O)C(OC)=CC1=O)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dalbergia nigra | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Dalbergia retusa | Ref. |
| Plantae | Fabaceae | Dalbergia spp. | Ref. |
|
|
zoom in
| Organism | Dalbergia spp. |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Eyton,Tetrahedron,21,(1965),2683 |
|---|
|
