| Name |
Coumarin |
| Formula |
C9H6O2 |
| Mw |
146.03677944 |
| CAS RN |
91-64-5 |
| C_ID |
C00002460
, 
|
| InChIKey |
ZYGHJZDHTFUPRJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H6O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H |
| SMILES |
O=c1ccc2ccccc2o1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Araliaceae | Hydrocotyle sibthorpioides  | Ref. |
| Plantae | Araliaceae | Tetrapanax papyriferus | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Eupatorium odoratum  | Ref. |
| Plantae | Asteraceae | Liatris squarrosa | Ref. |
| Plantae | Balsaminaceae | Impatiens siculifer | Ref. |
| Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Scabiosa comosa | Ref. |
| Plantae | Fabaceae | Amburana cearensis | Ref. |
| Plantae | Fabaceae | Dalea tuberculata | Ref. |
| Plantae | Fabaceae | Dipteryx odorata  | Ref. |
| Plantae | Fabaceae | Dipteryx punctata  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Hypericaceae | Hypericum japonicum  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Lauraceae | Cinnamomum burmannii Nees ex BI  | Ref. |
| Plantae | Lauraceae | Cinnamomum cassia  | Ref. |
| Plantae | Lauraceae | Cinnamomum loureirii  | Ref. |
| Plantae | Moraceae | Ficus simplicissima | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Rutaceae | Clausena excavata  | Ref. |
| Plantae | Scrophulariaceae | Verbascum thapsus  | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
| - | - | | Ref. |
| - | - | Alyxia lucida | Ref. |
| - | - | Torresea cearensis | Ref. |
|
|
zoom in
| Organism | Asparagus officinalis | | Reference | Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Du, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 20, (1995), 232. |
|---|
|