| Name |
Toxol |
| Formula |
C13H14O3 |
| Mw |
218.09429431 |
| CAS RN |
26296-56-0 |
| C_ID |
C00002410
, 
|
| InChIKey |
KWZYQHQNOWRQRG-QWAQRTLVNA-N |
| InChICode |
InChI=1S/C13H14O3/c1-7(2)13-12(15)10-6-9(8(3)14)4-5-11(10)16-13/h4-6,12-13,15H,1H2,2-3H3/t12-,13+/m1/s1 |
| SMILES |
C=C(C)[C@@H]1Oc2ccc(C(C)=O)cc2[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Haplopappus heterophyllus | Ref. |
| Plantae | Asteraceae | Morithamnus crassus | Ref. |
| - | - | Aplopappus heterophyllus | Ref. |
| - | - | family Asteraceae spp. | Ref. |
|
|
zoom in
| Organism | family Asteraceae spp. | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|