| Name |
Triangularine |
| Formula |
C18H25NO5 |
| Mw |
335.17327292 |
| CAS RN |
87340-27-0 |
| C_ID |
C00002124
, 
|
| InChIKey |
GOENJWUGVSLZDQ-XWFWOTRYNA-N |
| InChICode |
InChI=1S/C18H25NO5/c1-4-12(3)17(21)24-15-7-9-19-8-6-14(16(15)19)11-23-18(22)13(5-2)10-20/h4-6,15-16,20H,7-11H2,1-3H3/b12-4-,13-5-/t15-,16-/m1/s1 |
| SMILES |
C/C=C(/C)C(=O)O[C@@H]1CCN2CC=C(COC(=O)/C(=CC)CO)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aristolochiaceae | Aristolochia triangularis | Ref. |
| Plantae | Asteraceae | Senecio triangularis | Ref. |
| Plantae | Boraginaceae | Alkanna tinctoria  | Ref. |
| Plantae | Boraginaceae | Symphytum asperum | Ref. |
|
|
zoom in
| Organism | Symphytum asperum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|