| Name |
Isatidine |
| Formula |
C18H25NO7 |
| Mw |
367.16310216 |
| CAS RN |
15503-86-3 |
| C_ID |
C00002094
, 
|
| InChIKey |
IDIMIWQPUHURPV-DFOGLULXNA-N |
| InChICode |
InChI=1S/C18H25NO7/c1-3-12-8-11(2)18(23,10-20)17(22)25-9-13-4-6-19(24)7-5-14(15(13)19)26-16(12)21/h3-4,11,14-15,20,23H,5-10H2,1-2H3/b12-3-/t11-,14-,15-,18-,19-/m1/s1 |
| SMILES |
C/C=C1/C[C@@H](C)[C@](O)(CO)C(=O)OCC2=CC[N+]3([O-])CC[C@@H](OC1=O)[C@@H]23 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Arg |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Senecio bupleuroides | Ref. |
| Plantae | Asteraceae | Senecio longifolius | Ref. |
| Plantae | Asteraceae | Senecio longilobus | Ref. |
| Plantae | Asteraceae | Senecio paucicazyculatus | Ref. |
| Plantae | Asteraceae | Senecio scleratus | Ref. |
|
|
zoom in
| Organism | Senecio paucicazyculatus | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|