| Name |
(-)-Cassine Cassine |
| Formula |
C18H35NO2 |
| Mw |
297.26677937 |
| CAS RN |
5227-24-7 |
| C_ID |
C00002027
, 
|
| InChIKey |
QPRMGHKASRLPJP-FFRIMDHNNA-N |
| InChICode |
InChI=1S/C18H35NO2/c1-15(20)11-9-7-5-3-4-6-8-10-12-17-13-14-18(21)16(2)19-17/h16-19,21H,3-14H2,1-2H3/t16-,17+,18-/m1/s1 |
| SMILES |
CC(=O)CCCCCCCCCC[C@H]1CC[C@@H](O)[C@@H](C)N1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Ala L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Celastraceae | Cassine metabelica | Ref. |
| Plantae | Fabaceae | Cassia carnaval | Ref. |
| Plantae | Fabaceae | Cassia excelsa | Ref. |
| Plantae | Fabaceae | Cassia spectabilis  | Ref. |
| Plantae | Fabaceae | Erythrophleum guineense E.Don.  | Ref. |
| Plantae | Fabaceae | Prosopis ruscifolia  | Ref. |
|
|
zoom in
| Organism | Cassia spectabilis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|