| Name |
Mucronine A |
| Formula |
C29H38N4O4 |
| Mw |
506.28930573 |
| CAS RN |
38840-25-4 |
| C_ID |
C00002004
, 
|
| InChIKey |
ZGVZGFFCCVLGFC-KRYODQCPNA-N |
| InChICode |
InChI=1S/C29H38N4O4/c1-6-19(2)26-29(36)31-23(17-20-10-8-7-9-11-20)27(34)30-15-14-21-12-13-25(37-5)22(16-21)18-24(33(3)4)28(35)32-26/h7-16,19,23-24,26H,6,17-18H2,1-5H3,(H,30,34)(H,31,36)(H,32,35)/b15-14-/t19-,23-,24-,26-/m0/s1 |
| SMILES |
CC[C@H](C)[C@@H]1NC(=O)[C@@H](N(C)C)Cc2cc(ccc2OC)/C=CNC(=O)[C@H](Cc2ccccc2)NC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rhamnaceae | Ziziphus abyssinica  | Ref. |
| Plantae | Rhamnaceae | Ziziphus mucronata  | Ref. |
| Plantae | Rhamnaceae | Zizyphus abyssinica  | Ref. |
| Plantae | Rhamnaceae | Zizyphus mucronata  | Ref. |
|
|
zoom in
| Organism | Zizyphus mucronata | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|