| Name |
Thalmine |
| Formula |
C37H40N2O6 |
| Mw |
608.28863702 |
| CAS RN |
7682-65-7 |
| C_ID |
C00001922
, 
|
| InChIKey |
CASHVZNATRNXDE-REMWNZQGNA-N |
| InChICode |
InChI=1S/C37H40N2O6/c1-38-14-12-24-19-32(42-4)34-20-27(24)29(38)17-23-8-11-31(41-3)33(18-23)44-25-9-6-22(7-10-25)16-30-28-21-35(43-5)36(40)37(45-34)26(28)13-15-39(30)2/h6-11,18-21,29-30,40H,12-17H2,1-5H3/t29-,30-/m0/s1 |
| SMILES |
COc1ccc2cc1Oc1ccc(cc1)C[C@H]1c3cc(OC)c(O)c(c3CCN1C)Oc1cc3c(cc1OC)CCN(C)[C@H]3C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lauraceae | Ocotea puberula | Ref. |
| Plantae | Ranunculaceae | Thalictrum buschianum | Ref. |
| Plantae | Ranunculaceae | Thalictrum minus L. | Ref. |
| Plantae | Ranunculaceae | Thalictrum sp. | Ref. |
| Plantae | Ranunculaceae | Thalictrum spp. | Ref. |
| Plantae | Ranunculaceae | Thalictrum triternatum | Ref. |
|
|
zoom in
| Organism | Thalictrum sp. | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|