| Name |
Crinamine |
| Formula |
C17H19NO4 |
| Mw |
301.1314081 |
| CAS RN |
639-41-8 |
| C_ID |
C00001569
, 
|
| InChIKey |
YGPRSGKVLATIHT-NIUZHJOKNA-N |
| InChICode |
InChI=1S/C17H19NO4/c1-20-11-2-3-17-12-6-14-13(21-9-22-14)4-10(12)7-18(8-16(17)19)15(17)5-11/h2-4,6,11,15-16,19H,5,7-9H2,1H3/t11-,15-,16-,17-/m0/s1 |
| SMILES |
CO[C@H]1C=C[C@@]23c4cc5c(cc4C[N@@](C[C@@H]2O)[C@H]3C1)OCO5 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaryllidaceae | Ammocharis coranica | Ref. |
| Plantae | Amaryllidaceae | Brunsvigia josephinae | Ref. |
| Plantae | Amaryllidaceae | Brunsvigia radulosa | Ref. |
| Plantae | Amaryllidaceae | Crinum asiaticum  | Ref. |
| Plantae | Amaryllidaceae | Crinum bulbispermum | Ref. |
| Plantae | Amaryllidaceae | Crinum glaucum  | Ref. |
| Plantae | Amaryllidaceae | Crinum jagus  | Ref. |
| Plantae | Amaryllidaceae | Crinum macowanii  | Ref. |
| Plantae | Amaryllidaceae | Narcissus bujei | Ref. |
| Plantae | Amaryllidaceae | Pancratium foetidum | Ref. |
| Plantae | Dioscoreaceae | Dioscorea dregeana  | Ref. |
|
|
zoom in
| Organism | Crinum asiaticum | | Reference | Elgorashi, et al., Planta Med, 70, (2004), 260.
Campbell, et al., Phytochemistry, 53, (2000), 587.
Koorbanally, et al., Phytochemistry, 54, (2000), 93.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter17 |
|---|
|