| Name |
Indican Indican glucoside Uroxanthin |
| Formula |
C14H17NO6 |
| Mw |
295.10558728 |
| CAS RN |
487-60-5 |
| C_ID |
C00001541
, 
|
| InChIKey |
XVARCVCWNFACQC-YDEHRPHYNA-N |
| InChICode |
InChI=1S/C14H17NO6/c16-6-10-11(17)12(18)13(19)14(21-10)20-9-5-15-8-4-2-1-3-7(8)9/h1-5,10-19H,6H2/t10-,11-,12+,13-,14-/m1/s1 |
| SMILES |
OCC1O[C@@H](Oc2c[nH]c3ccccc23)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Isatis indigotica  | Ref. |
| Plantae | Cruciferae | Isatis tinctoria  | Ref. |
| Plantae | Fabaceae | Indigofera spp.  | Ref. |
| Plantae | Fabaceae | Indigofera tinctoria  | Ref. |
| Plantae | Polygonaceae | Polygonum perfoliatum | Ref. |
| Plantae | Polygonaceae | Polygonum tinctorium | Ref. |
| Plantae | Polygonaceae | Polygonum tinctorum | Ref. |
|
|
zoom in
| Organism | Indigofera tinctoria | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|