| Name |
N-Methylmescaline |
| Formula |
C12H19NO3 |
| Mw |
225.13649348 |
| CAS RN |
4838-97-4 |
| C_ID |
C00001421
, 
|
| InChIKey |
OTXANOLOOUNVSR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H19NO3/c1-13-6-5-9-7-10(14-2)12(16-4)11(8-9)15-3/h7-8,13H,5-6H2,1-4H3 |
| SMILES |
CNCCc1cc(OC)c(OC)c(OC)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cactaceae | Lophophora willamsii | Ref. |
| Plantae | Cactaceae | Lophophora williamsii | Ref. |
| Plantae | Fabaceae | Acacia rigidula Benth. | Ref. |
| Plantae | Fabaceae | Alhagi pseudalhagi  | Ref. |
| Plantae | Fabaceae | Alhagi pseudoalhagi | Ref. |
| - | - | Anhalonium lewinii | Ref. |
|
|
zoom in
| Organism | Alhagi pseudalhagi | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|