| Name |
(+)-Ascorbic acid L-Ascorbic acid L-Ascorbate Vitamin C |
| Formula |
C6H8O6 |
| Mw |
176.03208799 |
| CAS RN |
50-81-7 |
| C_ID |
C00001179
, 
|
| InChIKey |
CIWBSHSKHKDKBQ-DOMZIZNONA-N |
| InChICode |
InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
| SMILES |
O=C1O[C@H]([C@@H](O)CO)C(O)=C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona squamosa  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Araceae | Colocasia escultenta | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Oxalidaceae | Oxalis corniculata  | Ref. |
| Plantae | Piperaceae | Peperomia sui | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Rubus idaeus L.  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Colocasia escultenta | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|