| Name |
6-Hydroxykaempferol |
| Formula |
C15H10O7 |
| Mw |
302.04265268 |
| CAS RN |
4324-55-4 |
| C_ID |
C00001051
, 
|
| InChIKey |
LFPHMXIOQBBTSS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O7/c16-7-3-1-6(2-4-7)15-14(21)13(20)10-9(22-15)5-8(17)11(18)12(10)19/h1-5,16-19,21H |
| SMILES |
O=c1c(O)c(-c2ccc(O)cc2)oc2cc(O)c(O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Glomeraceae | Glomus intraradices | Ref. |
| Plantae | Asteraceae | Baccharis spp. | Ref. |
| Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
| Plantae | Asteraceae | Coreopsis spp. | Ref. |
| Plantae | Asteraceae | Neurolaena oaxacana | Ref. |
| Plantae | Asteraceae | Tetragonotheca texana | Ref. |
| Plantae | Betulaceae | Alnus glutinosa  | Ref. |
| Plantae | Fabaceae | Galega officinalis  | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| - | - | Helminthia echioides | Ref. |
|
|
zoom in
| Organism | Coreopsis spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Cawford,Bot.Gaz.,144,(1983),577 |
|---|
|