| Name |
Neoeriocitrin |
| Formula |
C27H32O15 |
| Mw |
596.17412036 |
| CAS RN |
13241-32-2 |
| C_ID |
C00000986
, 
|
| InChIKey |
OBKKEZLIABHSGY-UYJCRREGNA-N |
| InChICode |
InChI=1S/C27H32O15/c1-9-20(33)22(35)24(37)26(38-9)42-25-23(36)21(34)18(8-28)41-27(25)39-11-5-14(31)19-15(32)7-16(40-17(19)6-11)10-2-3-12(29)13(30)4-10/h2-6,9,16,18,20-31,33-37H,7-8H2,1H3/t9-,16+,18+,20+,21-,22+,23+,24-,25-,26+,27-/m1/s1 |
| SMILES |
CC1O[C@@H](OC2[C@H](Oc3cc(O)c4c(c3)O[C@H](c3ccc(O)c(O)c3)CC4=O)OC(CO)[C@@H](O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Citrus aurantium L. var. amara  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sp.  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Simaroubaceae | Ailanthus integrifolia | Ref. |
|
|
zoom in
| Organism | Citrus sp. | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|