| Name |
Garbanzol |
| Formula |
C15H12O5 |
| Mw |
272.06847349 |
| CAS RN |
1226-22-8 |
| C_ID |
C00000964
, 
|
| InChIKey |
VRTGGIJPIYOHGT-PVRQQBJHNA-N |
| InChICode |
InChI=1S/C15H12O5/c16-9-3-1-8(2-4-9)15-14(19)13(18)11-6-5-10(17)7-12(11)20-15/h1-7,14-17,19H/t14-,15+/m0/s1 |
| SMILES |
O=C1c2ccc(O)cc2O[C@H](c2ccc(O)cc2)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Rhus spp. | Ref. |
| Plantae | Bignoniaceae | Tecoma stans  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Fabaceae | Acacia mearnsii  | Ref. |
| Plantae | Fabaceae | Cicer arietinum  | Ref. |
| Plantae | Fabaceae | Onobrychis viciifolia  | Ref. |
| Plantae | Fabaceae | Pterocarpus marsupium  | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
|
|
zoom in
| Organism | Acacia mearnsii | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 668,Flavanones and dihydroflavonols
Wong,Phytochem.,4,(1965),89
Young,Am.J.Bot.,66,(1979),502 |
|---|
|