| Name |
Asebogenin asmaxanthone |
| Formula |
C16H16O5 |
| Mw |
288.09977362 |
| CAS RN |
520-42-3 |
| C_ID |
C00000940
, 
|
| InChIKey |
UPXIBKPHJYQSGP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H16O5/c1-21-12-8-14(19)16(15(20)9-12)13(18)7-4-10-2-5-11(17)6-3-10/h2-3,5-6,8-9,17,19-20H,4,7H2,1H3 |
| SMILES |
COc1cc(O)c(C(=O)CCc2ccc(O)cc2)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia rigida  | Ref. |
| Plantae | Ericaceae | Lyonia formosa | Ref. |
| Plantae | Ericaceae | Pieris japonica  | Ref. |
| Plantae | Ericaceae | Rhododendron spp. | Ref. |
| Plantae | Hydrocharitaceae | Thalassia ciliatum | Ref. |
| Plantae | Myristicaceae | Iryanthera laevis | Ref. |
| Plantae | Piperaceae | Piper aduncum  | Ref. |
| Plantae | Pteridaceae | Adiantum poretti | Ref. |
| Plantae | Pteridaceae | Cheilanthes welwitschii | Ref. |
| Plantae | Pteridaceae | Notholaena lemmonii | Ref. |
| Plantae | Pteridaceae | Notholaena sulphurea | Ref. |
| Plantae | Pteridaceae | Pityrogramma calomelanos  | Ref. |
| Plantae | Salicaceae | Populus x jackii | Ref. |
|
|
zoom in
| Organism | Rhododendron spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Mabry,Phytochem.,14,81975),1448
Hitz,Z.Naturforsch.C.,37,(1982),337 |
|---|
|