| Name |
Gibberellin A12 aldehyde |
| Formula |
C20H28O3 |
| Mw |
316.20384476 |
| CAS RN |
19436-07-8 |
| C_ID |
C00000886
, 
|
| InChIKey |
ZCTUNYRXJKLWPY-QGFSWZRUNA-N |
| InChICode |
InChI=1S/C20H28O3/c1-12-9-20-10-13(12)5-6-15(20)18(2)7-4-8-19(3,17(22)23)16(18)14(20)11-21/h11,13-16H,1,4-10H2,2-3H3,(H,22,23)/t13-,14+,15+,16+,18+,19-,20-/m1/s1 |
| SMILES |
C=C1C[C@]23C[C@H]1CCC2[C@]1(C)CCC[C@@](C)(C(=O)O)[C@H]1[C@@H]3C=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Nectriaceae | Fusarium fujikuroi | Ref. |
| Fungi | Nectriaceae | Gibberella fujikuroi | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cucurbitaceae | Cucurbita maxima  | Ref. |
| Plantae | Cucurbitaceae | Cucurbita sp.  | Ref. |
| Plantae | Fabaceae | Phaseolus spp. | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| - | - | Trachyspermum ammi  | Ref. |
|
|
zoom in
| Organism | Cucurbita maxima | | Reference | Graebe,Biochemistry and Chemistry of Plant Growth Regulators,Acad Sci.German Democratic republic,(1974),p1 |
|---|
|