| Name |
(-)-Limonene
(S)-(-)-Limonene
L-Limonene |
| Formula |
C10H16 |
| Mw |
136.12520051 |
| CAS RN |
5989-54-8 |
| C_ID |
C00000803
, 
|
| InChIKey |
XMGQYMWWDOXHJM-UEQNJFAPNA-N |
| InChICode |
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m1/s1 |
| SMILES |
C=C(C)[C@@H]1CC=C(C)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Daucus carota | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
| Plantae | Fabaceae | Trifolium pratense | Ref. |
| Plantae | Labiatae | Mentha longifolia | Ref. |
| Plantae | Labiatae | Mentha piperita | Ref. |
| Plantae | Labiatae | Mentha spicata | Ref. |
| Plantae | Labiatae | Perilla frutescens | Ref. |
| Plantae | Labiatae | Salvia officinalis | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora | Ref. |
| Plantae | Myrtaceae | Psidium guajava | Ref. |
| Plantae | Pinaceae | Abies grandis | Ref. |
| Plantae | Pinaceae | Pinus banksiana | Ref. |
| Plantae | Pinaceae | Pinus contorta var. latifolia | Ref. |
| Plantae | Pinaceae | Pinus taeda | Ref. |
| Plantae | Rutaceae | Citrofortunella mitis | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Rutaceae | Citrus unshiu | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum | Ref. |
| - | - | Pelargonicum graveolens | Ref. |
|
|
zoom in
| Organism | Trifolium pratense |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
