| Name |
(+-)-Grossamide Grossamide |
| Formula |
C36H36N2O8 |
| Mw |
624.24716614 |
| CAS RN |
80510-06-1 |
| C_ID |
C00000665
, 
|
| InChIKey |
DROXVBRNXCRUHP-UJDVVNQINA-N |
| InChICode |
InChI=1S/C36H36N2O8/c1-44-30-21-25(8-13-29(30)41)34-33(36(43)38-18-16-23-5-11-27(40)12-6-23)28-19-24(20-31(45-2)35(28)46-34)7-14-32(42)37-17-15-22-3-9-26(39)10-4-22/h3-14,19-21,33-34,39-41H,15-18H2,1-2H3,(H,37,42)(H,38,43)/b14-7+/t33-,34+/m0/s1 |
| SMILES |
COc1cc([C@@H]2Oc3c(OC)cc(/C=C/C(=O)NCCc4ccc(O)cc4)cc3[C@H]2C(=O)NCCc2ccc(O)cc2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Xylopia aethiopica  | Ref. |
| Plantae | Cannabaceae | Cannabis sativa  | Ref. |
| Plantae | Solanaceae | Capsicum annuum var.grossum  | Ref. |
| Plantae | Solanaceae | Hyoscyamus niger  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
|
|
zoom in
| Organism | Hyoscyamus niger | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|