| Name |
Lunularic acid |
| Formula |
C15H14O4 |
| Mw |
258.08920894 |
| CAS RN |
23255-59-6 |
| C_ID |
C00000212
, 
|
| InChIKey |
GFSQDOUEUWXRSL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H14O4/c16-12-8-5-10(6-9-12)4-7-11-2-1-3-13(17)14(11)15(18)19/h1-3,5-6,8-9,16-17H,4,7H2,(H,18,19) |
| SMILES |
O=C(O)c1c(O)cccc1CCc1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium spp. | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Calypogeia | Calypogeia tosana | Ref. |
| Plantae | Hydrangeaceae | Hydrangea macrophylla | Ref. |
| Plantae | Jubulaceae | Frullania convoluta | Ref. |
| Plantae | Marchantiaceae | Marchantia polymorpha | Ref. |
| Plantae | Ophioglossaceae | Lunularia cruciata | Ref. |
| Plantae | Ophioglossaceae | Lunularia spp. | Ref. |
| Plantae | Ricciaceae | Ricciocarpos natans | Ref. |
| - | - | Blasia pusilla | Ref. |
| - | - | Corsinia coriandrina | Ref. |
| - | - | Lophocolea heterophylla | Ref. |
|
|
zoom in
| Organism | Hydrangea macrophylla |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998)
Gorham,Phytochem.,16,(1977),249 |
|---|
|
