| Name |
Vicenin Vicenin 2 Vicenin II Apigenin 6,8-di-C-glucoside Vicenin-2 |
| Formula |
C27H30O15 |
| Mw |
594.15847029 |
| CAS RN |
23666-13-9 |
| C_ID |
C00006229
, 
|
| InChIKey |
FIAAVMJLAGNUKW-ZYYYSNSLNA-N |
| InChICode |
InChI=1S/C27H30O15/c28-6-12-17(32)21(36)23(38)26(41-12)15-19(34)14-10(31)5-11(8-1-3-9(30)4-2-8)40-25(14)16(20(15)35)27-24(39)22(37)18(33)13(7-29)42-27/h1-5,12-13,17-18,21-24,26-30,32-39H,6-7H2/t12-,13-,17+,18+,21-,22-,23+,24-,26-,27-/m0/s1 |
| SMILES |
O=c1cc(-c2ccc(O)cc2)oc2c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Centaurea melitensis L. | Ref. |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Asteraceae | Cirsium oligophyllum | Ref. |
| Plantae | Asteraceae | Eupatorium serotinum | Ref. |
| Plantae | Asteraceae | Tragopogon spp. | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Caryophyllaceae | Spergularia rubra  | Ref. |
| Plantae | Caryophyllaceae | Stellaria media  | Ref. |
| Plantae | Cucurbitaceae | Cucumis sativus  | Ref. |
| Plantae | Cyperaceae | Cyperus alopecuroides | Ref. |
| Plantae | Ephedraceae | Ephedra aphylla | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Sophora spp. | Ref. |
| Plantae | Fabaceae | Trigonella foenum-graecum  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Labiatae | Ballota foetida | Ref. |
| Plantae | Labiatae | Meehania urticifolia | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Salvia lanigera | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Salvia spinosa  | Ref. |
| Plantae | Labiatae | Salvia triloba  | Ref. |
| Plantae | Labiatae | Stachys officinalis (L.) Trev.  | Ref. |
| Plantae | Labiatae | Teucridium parvifolium | Ref. |
| Plantae | Labiatae | Thymus membranaceus | Ref. |
| Plantae | Labiatae | Tripora divaricata | Ref. |
| Plantae | Labiatae | Vitex lucens | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Petrosaviaceae/Nartheciaceae | Japonolirion osense | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Rosaceae | Cydonia oblonga  | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Citrus unshiu  | Ref. |
| Plantae | Scrophulariaceae | Hebe parviflora | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Violaceae | Viola tricolor  | Ref. |
| Plantae | Violaceae | Viola yedoensis | Ref. |
|
|
zoom in
| Organism | Vitex lucens | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Chopin,C.R.Acad.Sci.Paris,259,(1964),3111
Gentili,J.Org.Chem.,33,(1968),1571 |
|---|
|