| Name |
Stachydrine |
| Formula |
C7H13NO2 |
| Mw |
143.09462867 |
| CAS RN |
471-87-4 |
| C_ID |
C00002074
, 
|
| InChIKey |
CMUNUTVVOOHQPW-MDOHGIEYNA-N |
| InChICode |
InChI=1S/C7H13NO2/c1-8(2)5-3-4-6(8)7(9)10/h6H,3-5H2,1-2H3/t6-/m0/s1 |
| SMILES |
C[N+]1(C)CCC[C@H]1C(=O)[O-] |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asphodelaceae | Asphodelus microcarpus  | Ref. |
| Plantae | Asteraceae | Achillea millefolium  | Ref. |
| Plantae | Capparaceae | Capparis aegyptia  | Ref. |
| Plantae | Capparaceae | Capparis deserti | Ref. |
| Plantae | Capparaceae | Capparis leucophylla | Ref. |
| Plantae | Capparaceae | Capparis spinosa L.  | Ref. |
| Plantae | Capparaceae | Capparis tomentosa  | Ref. |
| Plantae | Combretaceae | Combretum micranthum  | Ref. |
| Plantae | Fabaceae | Desmodium triflorum  | Ref. |
| Plantae | Fabaceae | Erythrina variegata  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Labiatae | Eremostachys speciosa | Ref. |
| Plantae | Labiatae | Lagochilus inebrians Bge. | Ref. |
| Plantae | Labiatae | Lagochilus pubescens | Ref. |
| Plantae | Labiatae | Lagochilus setulosus | Ref. |
| Plantae | Labiatae | Lamium album L.  | Ref. |
| Plantae | Labiatae | Leonurus heterophyllus  | Ref. |
| Plantae | Labiatae | Leonurus sibiricus  | Ref. |
| Plantae | Labiatae | Leonurus turkestanicus | Ref. |
| Plantae | Labiatae | Stachys balansae | Ref. |
| Plantae | Labiatae | Stachys betoniciflora | Ref. |
| Plantae | Labiatae | Stachys betonicifolia | Ref. |
| Plantae | Labiatae | Stachys hissarica | Ref. |
| Plantae | Labiatae | Stachys lanata | Ref. |
| Plantae | Labiatae | Stachys tuberifera | Ref. |
| Plantae | Labiatae | Stachys tubifera | Ref. |
| Plantae | Lamiaceae | Betonica officinalis  | Ref. |
| Plantae | Moraceae | Cudrania tricuspidata  | Ref. |
| Plantae | Rutaceae | Citrus grandis  | Ref. |
| Plantae | Rutaceae | Citrus natsudaidai  | Ref. |
| Plantae | Rutaceae | Citrus unshiu  | Ref. |
| Plantae | Sabiaceae | Sabia schumanniana | Ref. |
| Plantae | Urticaceae | Urtica cannabina  | Ref. |
|
|
zoom in
| Organism | Cudrania tricuspidata | | Reference | Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|