| Name |
Sakuranetin 5,4'-Dihydroxy-7-methoxyflavanone Naringenin 7-O-methyl ether |
| Formula |
C16H14O5 |
| Mw |
286.08412356 |
| CAS RN |
2957-21-3 |
| C_ID |
C00000999
, 
|
| InChIKey |
DJOJDHGQRNZXQQ-YQTOOIBONA-N |
| InChICode |
InChI=1S/C16H14O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-7,14,17-18H,8H2,1H3/t14-/m0/s1 |
| SMILES |
COc1cc(O)c2c(c1)O[C@H](c1ccc(O)cc1)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina havanensis | Ref. |
| Plantae | Asteraceae | Artemisia campestris  | Ref. |
| Plantae | Asteraceae | Baccharis spp. | Ref. |
| Plantae | Asteraceae | Polymnia fruticosa | Ref. |
| Plantae | Betulaceae | Betula spp. | Ref. |
| Plantae | Boraginaceae | Heliotropium filifolium | Ref. |
| Plantae | Boraginaceae | Heliotropium glutinosum | Ref. |
| Plantae | Celastraceae | Microtropis japonica | Ref. |
| Plantae | Combretaceae | Terminalia fagifolia | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Mimosa hostilis | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Juglandaceae | Juglans spp.  | Ref. |
| Plantae | Labiatae | Origanum calcaratum | Ref. |
| Plantae | Labiatae | Origanum dictamnus  | Ref. |
| Plantae | Labiatae | Origanum floribundum | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum microphyllum | Ref. |
| Plantae | Labiatae | Origanum onites  | Ref. |
| Plantae | Labiatae | Origanum syriacum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Glandulosum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Hirtum  | Ref. |
| Plantae | Piperaceae | Piper crassinervium Kunth | Ref. |
| Plantae | Piperaceae | Piper lhotzkyanum | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Rhamnaceae | Rhamnus davurica | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus cerasus  | Ref. |
| Plantae | Rosaceae | Prunus spp.  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Xanthorrhoeaceae | Xanthorrhoea hastilis  | Ref. |
| Plantae | Zingiberaceae | Boesenbergia rotunda (L.) Mansf.Kulturpfl.  | Ref. |
|
|
zoom in
| Organism | Prunus spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 323,Flavanones and dihydroflavonols
Asahina,J.Pharm.Soc.Jpn.,(1908),213
Kodama,Phytochem.,31,(1992),3807 |
|---|
|