| Name |
Quinic acid |
| Formula |
C7H12O6 |
| Mw |
192.06338812 |
| CAS RN |
36413-60-2 |
| C_ID |
C00034185
, 
|
| InChIKey |
AAWZDTNXLSGCEK-QLAIBGQYNA-N |
| InChICode |
InChI=1S/C7H12O6/c8-3-1-7(13,6(11)12)2-4(9)5(3)10/h3-5,8-10,13H,1-2H2,(H,11,12)/t3-,4-,5-,7-/m0/s1 |
| SMILES |
O=C(O)[C@]1(O)C[C@H](O)[C@@H](O)[C@@H](O)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
| Plantae | Combretaceae | Terminalia chebula  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea var. italica  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Lotus japonicus | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Magnoliaceae | Magnolia denudata  | Ref. |
| Plantae | Magnoliaceae | Magnolia liliiflora  | Ref. |
| Plantae | Moraceae | Ficus carica  | Ref. |
| Plantae | Myrtaceae | Plinia cauliflora | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus persica  | Ref. |
| Plantae | Rosaceae | Rosa rugosa  | Ref. |
| Plantae | Rubiaceae | Cinchona ledgariana | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus natsudaidai  | Ref. |
| Plantae | Rutaceae | Citrus unshiu  | Ref. |
| Plantae | Sapotaceae | Sebertia acuminata | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum habrochaites | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum neorickii | Ref. |
| Plantae | Solanaceae | Solanum parviflorum | Ref. |
| Plantae | Solanaceae | Solanum pennellii | Ref. |
| Plantae | Solanaceae | Solanum pimpinellifollium | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Urticaceae | Urtica dioica  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Eucaliptus citriodora | Ref. |
| - | - | Myrcianthes pungens | Ref. |
|
|
zoom in
| Organism | Citrus limon | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|