| Name |
alpha-Ylangene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
14912-44-8 |
| C_ID |
C00003203
, 
|
| InChIKey |
VLXDPFLIRFYIME-FFWCQKOCNA-N |
| InChICode |
InChI=1S/C15H24/c1-9(2)11-7-8-15(4)12-6-5-10(3)14(15)13(11)12/h5,9,11-14H,6-8H2,1-4H3/t11-,12+,13+,14-,15-/m0/s1 |
| SMILES |
CC1=CCC2C3C(C(C)C)CC[C@]2(C)C13 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Ganodermataceae | Ganoderma lucidum  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica | Ref. |
| Plantae | Annonaceae | Cananga odorata | Ref. |
| Plantae | Annonaceae | Guatteriopsis blepharophylla | Ref. |
| Plantae | Annonaceae | Guatteriopsis hispida | Ref. |
| Plantae | Annonaceae | Xylopia aethiopica | Ref. |
| Plantae | Annonaceae | Xylopia parviflora | Ref. |
| Plantae | Apiaceae | Apium graveolens | Ref. |
| Plantae | Betulaceae | Betula sp. | Ref. |
| Plantae | Canellaceae | Canella winterana | Ref. |
| Plantae | Cannabaceae | Humulus lupulus | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cupressaceae | Juniperus oxycedrus | Ref. |
| Plantae | Fabaceae | Rhynchosia minima | Ref. |
| Plantae | Gymnomitriaceae | Marsupella emarginata | Ref. |
| Plantae | Labiatae | Perilla frutescens | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis | Ref. |
| Plantae | Labiatae | Thymus broussonetti | Ref. |
| Plantae | Labiatae | Thymus maroccanus | Ref. |
| Plantae | Labiatae | Thymus praecos | Ref. |
| Plantae | Lepidoziaceae | Lepidozia fauriana | Ref. |
| Plantae | Lepidoziaceae | Lepidozia vitrea | Ref. |
| Plantae | Meliaceae | Guarea macrophylla ssp.tuberculata | Ref. |
| Plantae | Pinaceae | Cedrus libani | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Pinaceae | Pinus sylvestris | Ref. |
| Plantae | Piperaceae | Piper nigrum | Ref. |
| Plantae | Rutaceae | Citrus wilsonii | Ref. |
| Plantae | Rutaceae | Fortunella margarita | Ref. |
| Plantae | Rutaceae | Murraya paniculata | Ref. |
| Plantae | Rutaceae | Poncirus trifoliate x Citrus sinensis | Ref. |
| Plantae | Solanaceae | Capsicum annuum | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
|
|
zoom in
| Organism | Citrus wilsonii |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
