| Name |
Labiatenic acid Rosmarinic acid |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
20283-92-5 |
| C_ID |
C00002770
, 
|
| InChIKey |
DOUMFZQKYFQNTF-LBOXRDHUNA-N |
| InChICode |
InChI=1S/C18H16O8/c19-12-4-1-10(7-14(12)21)3-6-17(23)26-16(18(24)25)9-11-2-5-13(20)15(22)8-11/h1-8,16,19-22H,9H2,(H,24,25)/b6-3+/t16-/m1/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)c(O)c1)O[C@H](Cc1ccc(O)c(O)c1)C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Anethum spp. | Ref. |
| Plantae | Apiaceae | Astrantia major  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Ligusticum spp. | Ref. |
| Plantae | Apiaceae | Sanicula europaea  | Ref. |
| Plantae | Apiaceae | Sanicula spp. | Ref. |
| Plantae | Araceae | Anthurium versicolor | Ref. |
| Plantae | Araceae | Colocasia esculenta  | Ref. |
| Plantae | Araliaceae | Centella asiatica  | Ref. |
| Plantae | Araliaceae | Hedera helix  | Ref. |
| Plantae | Boraginaceae | Lindelofia stylosa | Ref. |
| Plantae | Boraginaceae | Lithospermum ruderale | Ref. |
| Plantae | Boraginaceae | Symphytum officinale  | Ref. |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cucurbitaceae | Momordica balsamina  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Heliotropiaceae | Tournefortia sarmentosa | Ref. |
| Plantae | Hydrocharitaceae | Thalassia hemprichii | Ref. |
| Plantae | Labiatae | Agastache rugosa  | Ref. |
| Plantae | Labiatae | Clinopodium chinense var. parviflorum | Ref. |
| Plantae | Labiatae | Elsholtzia rugulosa Hemsl. | Ref. |
| Plantae | Labiatae | Melissa officinalis  | Ref. |
| Plantae | Labiatae | Mentha haplocalyx  | Ref. |
| Plantae | Labiatae | Mentha piperita  | Ref. |
| Plantae | Labiatae | Nepeta cadmea | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Origanum acutidens | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Labiatae | Perilla frutescens var.acuta.  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia bowleyana | Ref. |
| Plantae | Labiatae | Salvia cavaleriei | Ref. |
| Plantae | Labiatae | Salvia chinensis | Ref. |
| Plantae | Labiatae | Salvia flava  | Ref. |
| Plantae | Labiatae | Salvia lavandulifolia  | Ref. |
| Plantae | Labiatae | Salvia miltiorrhiza  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Salvia prionitis  | Ref. |
| Plantae | Labiatae | Salvia sonchifolia | Ref. |
| Plantae | Labiatae | Salvia yunnanensis | Ref. |
| Plantae | Labiatae | Satureja subspicata  | Ref. |
| Plantae | Labiatae | Teucrium scorodonia  | Ref. |
| Plantae | Labiatae | Thymus austriacus | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus citriodorus  | Ref. |
| Plantae | Labiatae | Thymus longicaulis  | Ref. |
| Plantae | Labiatae | Thymus oblongifolius | Ref. |
| Plantae | Labiatae | Thymus praecox  | Ref. |
| Plantae | Labiatae | Thymus pulegioides  | Ref. |
| Plantae | Labiatae | Thymus serpyllum  | Ref. |
| Plantae | Labiatae | Thymus sibthorpii | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Lamiaceae | Coleus forskohlii | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Apeiba tibourbou  | Ref. |
| Plantae | Malvaceae | Helicteres angustifolia  | Ref. |
| Plantae | Malvaceae | Helicteres isora  | Ref. |
| Plantae | Malvaceae | Helicteres isora L.  | Ref. |
| Plantae | Myrtaceae | Eucalyptus globulus  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Plantaginaceae | Veronica spicata | Ref. |
| Plantae | Rubiaceae | Hamelia patens  | Ref. |
| Plantae | Salviniaceae | Salvinia molesta | Ref. |
| Plantae | Verbenaceae | Verbena bipinnatifida | Ref. |
| Plantae | Verbenaceae | Verbena hybrida | Ref. |
| Plantae | Zosteraceae | Zostera marina | Ref. |
| Plantae | Zosteraceae | Zostera noltii | Ref. |
| - | - | Robdosia coetsa | Ref. |
|
|
zoom in
| Organism | Origanum acutidens | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|