| Name |
Cuscohygrine meso-Cuscohygrine |
| Formula |
C13H24N2O |
| Mw |
224.1888634 |
| CAS RN |
454-14-8 |
| C_ID |
C00002034
, 
|
| InChIKey |
ZEBIACKKLGVLFZ-TXEJJXNPNA-N |
| InChICode |
InChI=1S/C13H24N2O/c1-14-7-3-5-11(14)9-13(16)10-12-6-4-8-15(12)2/h11-12H,3-10H2,1-2H3/t11-,12+ |
| SMILES |
CN1CCC[C@@H]1CC(=O)C[C@@H]1CCCN1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convolvulaceae | Argyreia mollis | Ref. |
| Plantae | Convolvulaceae | Calystegia sepium  | Ref. |
| Plantae | Convolvulaceae | Convolvulus erinaceus | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum cataractarum | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum coca  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum novogranatense | Ref. |
| Plantae | Solanaceae | Atropa baetica | Ref. |
| Plantae | Solanaceae | Atropa belladonna  | Ref. |
| Plantae | Solanaceae | Cyphomandra betacea  | Ref. |
| Plantae | Solanaceae | Cyphomandra betaceae | Ref. |
| Plantae | Solanaceae | Datura ceratocaula  | Ref. |
| Plantae | Solanaceae | Datura spp. | Ref. |
| Plantae | Solanaceae | Datura stramonium  | Ref. |
| Plantae | Solanaceae | Hyoscyamus albus  | Ref. |
| Plantae | Solanaceae | Hyoscyamus boveanus | Ref. |
| Plantae | Solanaceae | Hyoscyamus desertorum | Ref. |
| Plantae | Solanaceae | Hyoscyamus muticus  | Ref. |
| Plantae | Solanaceae | Hyoscyamus niger  | Ref. |
| Plantae | Solanaceae | Mandragora autumnale | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Solanaceae | Mandragora autunnale | Ref. |
| Plantae | Solanaceae | Mandragora officinarum L.  | Ref. |
| Plantae | Solanaceae | Mandragora vernalis | Ref. |
| Plantae | Solanaceae | Physalis alkekengi  | Ref. |
| Plantae | Solanaceae | Physalis peruviana  | Ref. |
| Plantae | Solanaceae | Scopolia spp. | Ref. |
| Plantae | Solanaceae | Withania somnifera  | Ref. |
| - | - | Erythroxylon coca  | Ref. |
| - | - | Erythroxylon novogranatense | Ref. |
| - | - | Salpichora origanifolia | Ref. |
|
|
zoom in
| Organism | Erythroxylon novogranatense | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|