| Name |
1-Octen-3-ol Oct-1-en-3-ol |
| Formula |
C8H16O |
| Mw |
128.12011513 |
| CAS RN |
3391-86-4 |
| C_ID |
C00029423
, 
|
| InChIKey |
VSMOENVRRABVKN-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C8H16O/c1-3-5-6-7-8(9)4-2/h4,8-9H,2-3,5-7H2,1H3/t8-/m1/s1 |
| SMILES |
C=CC(O)CCCCC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Polyporaceae | Lentinus edodes Sing.  | Ref. |
| Fungi | Tricholomataceae | Tricholoma matsutake  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Gymnomitriaceae | Marsupella alpina | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Melissa officinalis  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Schizonepeta temuifolia | Ref. |
| Plantae | Labiatae | Thymus broussonetti | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus maroccanus | Ref. |
| Plantae | Labiatae | Thymus praecos | Ref. |
| Plantae | Lamiaceae | Calamintha nepeta subsp. glandulosa  | Ref. |
| Plantae | Laminariaceae | Laminaria japonica  | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Rubiaceae | Coffea canephora  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia amplexicaulis | Ref. |
| Plantae | Scrophulariaceae | Scrophularia oxysepala | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| - | - | Cow (Breath) | Ref. |
| - | - | Tuber borchii  | Ref. |
| - | - | Tuber brumale  | Ref. |
| - | - | Tuber excavatum | Ref. |
| - | - | Tuber indicum  | Ref. |
| - | - | Tuber magnatum  | Ref. |
| - | - | Tuber melanosporum  | Ref. |
| - | - | Tuber mesentericum | Ref. |
| - | - | Tuber oligospermum  | Ref. |
| - | - | Tuber panniferum | Ref. |
| - | - | Tuber rufum  | Ref. |
| - | - | Tuber uncinatum | Ref. |
|
|
zoom in
| Organism | Scrophularia amplexicaulis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|