| Name |
Corydine (+)-Corydine Glaucentrin Glaucentrine |
| Formula |
C20H23NO4 |
| Mw |
341.16270823 |
| CAS RN |
476-69-7 |
| C_ID |
C00025827
, 
|
| InChIKey |
IDQUPXZJURZAGF-UGPWUYPHNA-N |
| InChICode |
InChI=1S/C20H23NO4/c1-21-8-7-12-10-15(24-3)19(22)18-16(12)13(21)9-11-5-6-14(23-2)20(25-4)17(11)18/h5-6,10,13,22H,7-9H2,1-4H3/t13-/m0/s1 |
| SMILES |
COc1cc2c3c(c1O)-c1c(ccc(OC)c1OC)C[C@@H]3N(C)CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona cherimolia | Ref. |
| Plantae | Annonaceae | Annona reticulata  | Ref. |
| Plantae | Annonaceae | Annona squamosa  | Ref. |
| Plantae | Annonaceae | Xylopia danguyella | Ref. |
| Plantae | Berberidaceae | Berberis turcomanica | Ref. |
| Plantae | Euphorbiaceae | Croton hemiargyreus | Ref. |
| Plantae | Fumariaceae | Corydalis decumbens  | Ref. |
| Plantae | Fumariaceae | Corydalis lutea | Ref. |
| Plantae | Lauraceae | Nectandra salicifolia | Ref. |
| Plantae | Lauraceae | Neolitsea konishii | Ref. |
| Plantae | Lauraceae | Neolitsea parvigemma | Ref. |
| Plantae | Lauraceae | Ocotea vellosiana | Ref. |
| Plantae | Menispermaceae | Cissampelos fasciculata Benth | Ref. |
| Plantae | Menispermaceae | Kolobopetalum auriculatum Engl. | Ref. |
| Plantae | Menispermaceae | Stephania abyssinica Walp.  | Ref. |
| Plantae | Menispermaceae | Stephania cepharantha Hayata  | Ref. |
| Plantae | Menispermaceae | Stephania dinklagei | Ref. |
| Plantae | Menispermaceae | Stephania lincangensis | Ref. |
| Plantae | Menispermaceae | Stephania macrantha | Ref. |
| Plantae | Menispermaceae | Stephania micrantha H.S.Lo | Ref. |
| Plantae | Menispermaceae | Stephania tetrandra  | Ref. |
| Plantae | Menispermaceae | Stephania venosa | Ref. |
| Plantae | Menispermaceae | Stephania zippeliana Miq. | Ref. |
| Plantae | Papaveraceae | Glaucium corniculatum  | Ref. |
| Plantae | Papaveraceae | Glaucium flavum  | Ref. |
| Plantae | Papaveraceae | Papaver albiflorum | Ref. |
| Plantae | Papaveraceae | Papaver confine | Ref. |
| Plantae | Papaveraceae | Papaver croceum | Ref. |
| Plantae | Papaveraceae | Papaver stevenianum | Ref. |
|
|
zoom in
| Organism | Papaver croceum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|