| Name |
Callistephin Pelargonidin 3-O-beta-D-glucopyranoside |
| Formula |
C21H21O10 |
| Mw |
433.11347189 |
| CAS RN |
18466-51-8 |
| C_ID |
C00006630
, 
|
| InChIKey |
ABVCUBUIXWJYSE-DNLILFCWNA-O |
| InChICode |
InChI=1S/C21H20O10/c22-8-16-17(26)18(27)19(28)21(31-16)30-15-7-12-13(25)5-11(24)6-14(12)29-20(15)9-1-3-10(23)4-2-9/h1-7,16-19,21-22,26-28H,8H2,(H2-,23,24,25)/p+1/t16-,17-,18+,19-,21-/m1/s1 |
| SMILES |
OCC1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2ccc(O)cc2)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera caerulea | Ref. |
| Plantae | Asteraceae | Callistephus chinensis | Ref. |
| Plantae | Balsaminaceae | Impatiens balsamina  | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Convolvulaceae | Ipomoea nil  | Ref. |
| Plantae | Cruciferae | Matthiola incana  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Euphorbiaceae | Poinsettia spp. | Ref. |
| Plantae | Fabaceae | Erythrina spp. | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Myrsinaceae | Anagallis arvensis  | Ref. |
| Plantae | Myrtaceae | Eucalyptus citriodora  | Ref. |
| Plantae | Myrtaceae | Eugenia umbelliflora | Ref. |
| Plantae | Orchidaceae | Broughtonia spp. | Ref. |
| Plantae | Passifloraceae | Passiflora edulis  | Ref. |
| Plantae | Passifloraceae | Passiflora suberosa | Ref. |
| Plantae | Phrymaceae | Mimulus cardinalis | Ref. |
| Plantae | Phrymaceae | Mimulus lewisii | Ref. |
| Plantae | Plantaginaceae | Penstemon spp. | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Zea mays  | Ref. |
| Plantae | Podocarpaceae | Dacrydium spp. | Ref. |
| Plantae | Podocarpaceae | Podocarpus spp. | Ref. |
| Plantae | Rosaceae | Fragaria x ananassa | Ref. |
| Plantae | Rosaceae | Prunus spp.  | Ref. |
| Plantae | Rosaceae | Rosa spp. | Ref. |
| Plantae | Rosaceae | Rubus spp.  | Ref. |
| Plantae | Solanaceae | Petunia exserta | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Rosa spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Willstatter, Ann.,412,(1916),149 |
|---|
|