| Name |
Coumarin |
| Formula |
C9H6O2 |
| Mw |
146.03677944 |
| CAS RN |
91-64-5 |
| C_ID |
C00002460
, 
|
| InChIKey |
ZYGHJZDHTFUPRJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H6O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H |
| SMILES |
O=c1ccc2ccccc2o1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Araliaceae | Hydrocotyle sibthorpioides  | Ref. |
| Plantae | Araliaceae | Tetrapanax papyriferus | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Eupatorium odoratum  | Ref. |
| Plantae | Asteraceae | Liatris squarrosa | Ref. |
| Plantae | Balsaminaceae | Impatiens siculifer | Ref. |
| Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Scabiosa comosa | Ref. |
| Plantae | Fabaceae | Amburana cearensis | Ref. |
| Plantae | Fabaceae | Dalea tuberculata | Ref. |
| Plantae | Fabaceae | Dipteryx odorata  | Ref. |
| Plantae | Fabaceae | Dipteryx punctata  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Hypericaceae | Hypericum japonicum  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Lauraceae | Cinnamomum burmannii Nees ex BI  | Ref. |
| Plantae | Lauraceae | Cinnamomum cassia  | Ref. |
| Plantae | Lauraceae | Cinnamomum loureirii  | Ref. |
| Plantae | Moraceae | Ficus simplicissima | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Rutaceae | Clausena excavata  | Ref. |
| Plantae | Scrophulariaceae | Verbascum thapsus  | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
| - | - | | Ref. |
| - | - | Alyxia lucida | Ref. |
| - | - | Torresea cearensis | Ref. |
|
|
zoom in
| Organism | Tribulus terrestris | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|