| Name |
gamma-gurjunene epoxide (+)-gamma-Gurjunene gamma-Gurjunene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
22567-17-5 |
| C_ID |
C00020383
, 
|
| InChIKey |
DUYRYUZIBGFLDD-HJZAUIQONA-N |
| InChICode |
InChI=1S/C15H24/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h9,11-14H,1,5-8H2,2-4H3/t11-,12-,13-,14-/m1/s1 |
| SMILES |
C=C(C)[C@H]1C=C2[C@H](C)CC[C@@H]2[C@H](C)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Cananga odorata  | Ref. |
| Plantae | Annonaceae | Guatteriopsis blepharophylla | Ref. |
| Plantae | Annonaceae | Guatteriopsis hispida | Ref. |
| Plantae | Apiaceae | Peucedanum tauricum | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Petasites albus  | Ref. |
| Plantae | Asteraceae | Petasites hybridus  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Cyperaceae | Cyperus rotundus  | Ref. |
| Plantae | Dipterocarpaceae | Dipterocarpus dyeri | Ref. |
| Plantae | Jubulaceae | Frullania tamarisci | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Piperaceae | Piper arboreum  | Ref. |
| Plantae | Piperaceae | Piper fimbriulatum | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Rutaceae | Citrus latifolia  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Valerianaceae | Nardostachys chinensis  | Ref. |
| Plantae | Zingiberaceae | Curcuma kwangsiensis  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
|
|
zoom in
| Organism | Curcuma longa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|