| Name |
Myristicin |
| Formula |
C11H12O3 |
| Mw |
192.07864425 |
| CAS RN |
607-91-0 |
| C_ID |
C00002762
, 
|
| InChIKey |
BNWJOHGLIBDBOB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C11H12O3/c1-3-4-8-5-9(12-2)11-10(6-8)13-7-14-11/h3,5-6H,1,4,7H2,2H3 |
| SMILES |
C=CCc1cc(OC)c2c(c1)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Cyprinidae | Orthodon spp. | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Conioselinum vaginatum | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Ligusticum jeholense | Ref. |
| Plantae | Apiaceae | Ligusticum scoticum  | Ref. |
| Plantae | Apiaceae | Ligusticum sinense  | Ref. |
| Plantae | Apiaceae | Pastinaca sativa  | Ref. |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Aristolochiaceae | Asarum heteropoides var.mandshuricum | Ref. |
| Plantae | Aristolochiaceae | Asarum sieboldii  | Ref. |
| Plantae | Canellaceae | Canella winterana  | Ref. |
| Plantae | Labiatae | Perilla frutescens var.acuta  | Ref. |
| Plantae | Labiatae | Perilla frutescens var.crispa  | Ref. |
| Plantae | Lauraceae | Cinnamomum glanduliferum  | Ref. |
| Plantae | Lauraceae | Cinnamomum tenuifolium | Ref. |
| Plantae | Lauraceae | Lindera neesiana  | Ref. |
| Plantae | Magnoliaceae | Magnolia salicifolia  | Ref. |
| Plantae | Myristicaceae | Myristica fragrans  | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola  | Ref. |
| Plantae | Piperaceae | Piper aduncum  | Ref. |
| Plantae | Piperaceae | Piper regnellii  | Ref. |
| Plantae | Piperaceae | Piper solmsianum | Ref. |
| Plantae | Ranunculaceae | Nigella sativa L  | Ref. |
| Plantae | Zingiberaceae | Alpinia speciosa  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Petroselimum crispum | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|