| Name |
4-Hydroxybenzaldehyde p-Formylphenol p-Hydroxybenzaldehyde |
| Formula |
C7H6O2 |
| Mw |
122.03677944 |
| CAS RN |
123-08-0 |
| C_ID |
C00002657
, 
|
| InChIKey |
RGHHSNMVTDWUBI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C7H6O2/c8-5-6-1-3-7(9)4-2-6/h1-5,9H |
| SMILES |
O=Cc1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Botryllidae | Botryllus giganteum | Ref. |
| Animalia | Isodictyidae | Isodictya erinacea | Ref. |
| Fungi | Hymenochaetaceae | Phellinus igniarius  | Ref. |
| Plantae | Acanthaceae | Rhinacanthus nasutus | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asteraceae | Ligularia stenocephala Matsum.et Koidz. | Ref. |
| Plantae | Asteraceae | Taraxacum formosanum | Ref. |
| Plantae | Begoniaceae | Begonia nantoensis | Ref. |
| Plantae | Caryophyllaceae | Dianthus superbus var.longicalycinus (MAXIM.) WILL  | Ref. |
| Plantae | Caryophyllaceae | Drymaria diandra  | Ref. |
| Plantae | Celastraceae | Microtropis fokienensis | Ref. |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Convallariaceae | Tupistra chinensis | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Euphorbiaceae | Croton draco Schltdl.& Cham. | Ref. |
| Plantae | Euphorbiaceae | Croton hutchinsonianus | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Psoralea corylifolia  | Ref. |
| Plantae | Fabaceae | Pterocarpus marsupium  | Ref. |
| Plantae | Hydrangeaceae | Hydrangea chinensis | Ref. |
| Plantae | Hydrocharitaceae | Enhalus acoroides | Ref. |
| Plantae | Hydrocharitaceae | Thalassia testudinum | Ref. |
| Plantae | Hypoxidaceae | Curculigo capitulata | Ref. |
| Plantae | Icacinaceae | Gonocaryum calleryanum  | Ref. |
| Plantae | Juglandaceae | Engelhardia roxburghiana | Ref. |
| Plantae | Labiatae | Origanum acutidens | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Lauraceae | Cinnamomum subavenium MIQ. | Ref. |
| Plantae | Lauraceae | Cinnamomum tenuifolium | Ref. |
| Plantae | Lauraceae | Phoebe formosana | Ref. |
| Plantae | Lycopodiaceae | Lycopodium spp. | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Menispermaceae | Macrococculus pomiferus | Ref. |
| Plantae | Moraceae | Dorstenia prorepens | Ref. |
| Plantae | Orchidaceae | Gastrodia elata  | Ref. |
| Plantae | Orchidaceae | Gymnadenia conopsea R.BR. | Ref. |
| Plantae | Papaveraceae | Papaver somniferum  | Ref. |
| Plantae | Poaceae | Phyllostachys edulis | Ref. |
| Plantae | Poaceae | Sorghum bicolor  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Rosaceae | Spiraea formosana  | Ref. |
| Plantae | Rubiaceae | Plocama pendula | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Phellodendron japonicum MAXIM | Ref. |
| Plantae | Rutaceae | Zanthoxylum ailanthoides | Ref. |
| Plantae | Rutaceae | Zanthoxylum wutaiense | Ref. |
| Plantae | Santalaceae | Viscum articulactum | Ref. |
| Plantae | Santalaceae | Viscum coloratum  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
| Plantae | Taxodiaceae | Cryptomeria japonica | Ref. |
| Plantae | Vittariaceae | Vittaria anguste-elongata | Ref. |
| Plantae | Zingiberaceae | Alpinia blepharocalyx  | Ref. |
| Plantae | Zingiberaceae | Alpinia galanga  | Ref. |
| Plantae | Zingiberaceae | Curcuma comosa  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Ulva lactuca  | Ref. |
|
|
zoom in
| Organism | Origanum acutidens | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|