| Name |
Catechol Pyrocatechin Pyrocatechol |
| Formula |
C6H6O2 |
| Mw |
110.03677944 |
| CAS RN |
120-80-9 |
| C_ID |
C00002644
, 
|
| InChIKey |
YCIMNLLNPGFGHC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C6H6O2/c7-5-3-1-2-4-6(5)8/h1-4,7-8H |
| SMILES |
Oc1ccccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Plantae | Anacardiaceae | Semecarpus vitiensis | Ref. |
| Plantae | Asteraceae | Conyza bonariensis  | Ref. |
| Plantae | Asteraceae | Erigeron breviscapus  | Ref. |
| Plantae | Betulaceae | Betula luminifera | Ref. |
| Plantae | Cercidiphyllaceae | Cercidiphyllum japonicum var.sinense | Ref. |
| Plantae | Combretaceae | Terminalia chebula  | Ref. |
| Plantae | Cucurbitaceae | Luffa cylindrica  | Ref. |
| Plantae | Ericaceae | Gaultheria spp. | Ref. |
| Plantae | Fabaceae | Acacia nilotica  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Illiciaceae | Illicium fargesii | Ref. |
| Plantae | Lauraceae | Persea americana  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Nelumbonaceae | Nelumbo nucifera  | Ref. |
| Plantae | Orchidaceae | Gymnadenia conopsea R.BR. | Ref. |
| Plantae | Passifloraceae | Passiflora caerulea  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba  | Ref. |
| Plantae | Rosaceae | Malus doumeri varl formosana | Ref. |
| Plantae | Rosaceae | Prunus persica  | Ref. |
| Plantae | Rubiaceae | Uncaria gambir  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Salicaceae | Populus spp. | Ref. |
| Plantae | Salicaceae | Salix purpurea  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Salix purpurea | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|