| Name |
(S)-Isoboldine Isoboldine (+)-Isoboldine |
| Formula |
C19H21NO4 |
| Mw |
327.14705817 |
| CAS RN |
3019-51-0 |
| C_ID |
C00001869
, 
|
| InChIKey |
LINHZVMHXABQLB-UGPWUYPHNA-N |
| InChICode |
InChI=1S/C19H21NO4/c1-20-5-4-10-8-16(24-3)19(22)18-12-9-15(23-2)14(21)7-11(12)6-13(20)17(10)18/h7-9,13,21-22H,4-6H2,1-3H3/t13-/m0/s1 |
| SMILES |
COc1cc2c(cc1O)C[C@H]1c3c(cc(OC)c(O)c3-2)CCN1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona cherimolia | Ref. |
| Plantae | Annonaceae | Annona senegalensis  | Ref. |
| Plantae | Annonaceae | Anomianthus dulcis  | Ref. |
| Plantae | Annonaceae | Anonna salzmanii | Ref. |
| Plantae | Annonaceae | Cardiopetalum calophyllum | Ref. |
| Plantae | Annonaceae | Guatteria goudotiana | Ref. |
| Plantae | Annonaceae | Xylopia danguyella | Ref. |
| Plantae | Annonaceae | Xylopia parviflora  | Ref. |
| Plantae | Annonaceae | Xylopia vieillardi | Ref. |
| Plantae | Berberidaceae | Berberis brandisiana | Ref. |
| Plantae | Berberidaceae | Nandina domestica  | Ref. |
| Plantae | Cupressaceae | Thuja orientalis  | Ref. |
| Plantae | Euphorbiaceae | Croton celtidifolius | Ref. |
| Plantae | Euphorbiaceae | Croton lechleri Mull.Arg.  | Ref. |
| Plantae | Fabaceae | Erythrina abyssinica  | Ref. |
| Plantae | Fabaceae | Erythrina poeppigiana  | Ref. |
| Plantae | Fumariaceae | Ceratocapnos palaestinus | Ref. |
| Plantae | Fumariaceae | Corydalis bungeana  | Ref. |
| Plantae | Fumariaceae | Corydalis caucasia | Ref. |
| Plantae | Fumariaceae | Corydalis cava  | Ref. |
| Plantae | Fumariaceae | Corydalis gortschakovii | Ref. |
| Plantae | Fumariaceae | Corydalis intermedia | Ref. |
| Plantae | Fumariaceae | Corydalis nobilis | Ref. |
| Plantae | Fumariaceae | Corydalis solida  | Ref. |
| Plantae | Fumariaceae | Fumaria agraria | Ref. |
| Plantae | Fumariaceae | Fumaria bella | Ref. |
| Plantae | Fumariaceae | Fumaria capreolata  | Ref. |
| Plantae | Lauraceae | Aniba canelilla  | Ref. |
| Plantae | Lauraceae | Cassytha filiformis  | Ref. |
| Plantae | Lauraceae | Cryptocarya chinensis | Ref. |
| Plantae | Lauraceae | Dehaasia triandra | Ref. |
| Plantae | Lauraceae | Lindera glauca | Ref. |
| Plantae | Lauraceae | Litsea acuminata | Ref. |
| Plantae | Lauraceae | Litsea cubeba  | Ref. |
| Plantae | Lauraceae | Litsea glutinosa  | Ref. |
| Plantae | Lauraceae | Nectandra grandiflora | Ref. |
| Plantae | Lauraceae | Nectandra membranacea | Ref. |
| Plantae | Lauraceae | Nectandra salicifolia | Ref. |
| Plantae | Lauraceae | Neolitsea konishii | Ref. |
| Plantae | Lauraceae | Ocotea caesia | Ref. |
| Plantae | Lauraceae | Phoebe minutiflora | Ref. |
| Plantae | Menispermaceae | Cocculus laurifolius | Ref. |
| Plantae | Menispermaceae | Pachygone dasycarpa | Ref. |
| Plantae | Menispermaceae | Stephania cepharantha  | Ref. |
| Plantae | Menispermaceae | Stephania excentrica | Ref. |
| Plantae | Menispermaceae | Stephania officinarum | Ref. |
| Plantae | Monimiaceae | Peumus boldus  | Ref. |
| Plantae | Papaveraceae | Glaucium arabicum | Ref. |
| Plantae | Papaveraceae | Glaucium flavum  | Ref. |
| Plantae | Papaveraceae | Glaucium grandiflorum | Ref. |
| Plantae | Papaveraceae | Papaver orientale  | Ref. |
| Plantae | Papaveraceae | Papaver pinnatifidum | Ref. |
| Plantae | Papaveraceae | Papaver rhoeas  | Ref. |
| Plantae | Papaveraceae | Papaver setigerum | Ref. |
| Plantae | Papaveraceae | Stylophorum lasiocarpum | Ref. |
| Plantae | Ranunculaceae | Aconitum karacolicum | Ref. |
| Plantae | Ranunculaceae | Aconitum saposhnikovii | Ref. |
| Plantae | Ranunculaceae | Thalictrum collinum | Ref. |
| Plantae | Ranunculaceae | Thalictrum foetidum  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
|
|
zoom in
| Organism | Fumaria capreolata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|