| Name |
(-)-Loliolide (6S,7alphaR)-Loliolide Loliolide |
| Formula |
C11H16O3 |
| Mw |
196.10994438 |
| CAS RN |
5989-02-6 |
| C_ID |
C00019144
, 
|
| InChIKey |
XEVQXKKKAVVSMW-SMLPMWDWNA-N |
| InChICode |
InChI=1S/C11H16O3/c1-10(2)5-7(12)6-11(3)8(10)4-9(13)14-11/h4,7,12H,5-6H2,1-3H3/t7-,11+/m0/s1 |
| SMILES |
CC1(C)C[C@H](O)C[C@@]2(C)OC(=O)C=C12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Chromalveolata | Alariaceae | Undaria pinnatifida  | Ref. |
| Chromalveolata | Dictyotaceae | Dictyopteris divaricata | Ref. |
| Chromalveolata | Sargassaceae | Sargassum crassifolium J.Asgardh | Ref. |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Apiaceae | Prangos pabularia  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Onoseris alata | Ref. |
| Plantae | Asteraceae | Vernonia mollissima | Ref. |
| Plantae | Celastraceae | Maytenus cinfertiflorus | Ref. |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia helioscopia  | Ref. |
| Plantae | Euphorbiaceae | Macaranga triloba | Ref. |
| Plantae | Fabaceae | Melilotus messanensis | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
| Plantae | Gentianaceae | Canscora decussata  | Ref. |
| Plantae | Labiatae | Ajuga decumbens  | Ref. |
| Plantae | Lythraceae | Lythrum salicaria  | Ref. |
| Plantae | Meliaceae | Melia azedarach  | Ref. |
| Plantae | Menyanthaceae | Menyanthes trifoliata  | Ref. |
| Plantae | Moraceae | Broussonetia papyrifera  | Ref. |
| Plantae | Orobanchaceae | Siphonostegia chinensis | Ref. |
| Plantae | Piperaceae | Peperomia duclouxii C. DC. | Ref. |
| Plantae | Plantaginaceae | Digitalis lanata  | Ref. |
| Plantae | Plantaginaceae | Digitalis purpurea  | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Poaceae | Lolium perenne L.  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
|
|
zoom in
| Organism | Plantago major | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Takasaki, et al., Journal of Natural Products, 62, (1999), 972.
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Kimura, et al., Journal of Natural Products, 65, (2002), 57 |
|---|
|