| Name |
Kaempferol 7,4'-dimethyl ether 3,5-Dihydroxy-7,4'-dimethoxyflavone 3,5-Dihydroxy-7-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one Kaempferol-7,4'-dimethyl ether |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
15486-33-6 |
| C_ID |
C00004571
, 
|
| InChIKey |
KZBAXKKOXPLOBX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)17-16(20)15(19)14-12(18)7-11(22-2)8-13(14)23-17/h3-8,18,20H,1-2H3 |
| SMILES |
COc1ccc(-c2oc3cc(OC)cc(O)c3c(=O)c2O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Flourensia cernua | Ref. |
| Plantae | Asteraceae | Haplopappus hirtellus | Ref. |
| Plantae | Asteraceae | Madia elegans | Ref. |
| Plantae | Asteraceae | Ozothamnus scutellifolius | Ref. |
| Plantae | Asteraceae | Serratula strangulata  | Ref. |
| Plantae | Asteraceae | Stevia subpubescens | Ref. |
| Plantae | Betulaceae | Betula ermanii | Ref. |
| Plantae | Betulaceae | Betula nigra  | Ref. |
| Plantae | Boraginaceae | Heliotropium stenophyllum | Ref. |
| Plantae | Calceolariaceae | Calceolaria mexicana | Ref. |
| Plantae | Capparaceae | Cleome spinosa  | Ref. |
| Plantae | Cistaceae | Cistus spp. | Ref. |
| Plantae | Crassulaceae | Aeonium sedifolium | Ref. |
| Plantae | Hydrophyllaceae | Wigandia urens | Ref. |
| Plantae | Labiatae | Salvia chionopeplica | Ref. |
| Plantae | Lauraceae | Aniba spp. | Ref. |
| Plantae | Lennoaceae | Lennoa madreporoides | Ref. |
| Plantae | Nyctaginaceae | Mirabilis viscosa | Ref. |
| Plantae | Orchidaceae | Spiranthes australis (R.BROWN) LINDL. | Ref. |
| Plantae | Orobanchaceae | Odontites viscosa | Ref. |
| Plantae | Pteridaceae | Cheilanthes farinosa  | Ref. |
| Plantae | Pteridaceae | Cheilanthes grisea | Ref. |
| Plantae | Pteridaceae | Notholaena nivea | Ref. |
| Plantae | Pteridaceae | Notholaena standleyi | Ref. |
| Plantae | Pteridaceae | Pityrogramma triangularis | Ref. |
| Plantae | Sapindaceae | Dodonaea viscosa  | Ref. |
| Plantae | Tamaricaceae | Tamarix chinensis | Ref. |
| Plantae | Zingiberaceae | Alpinia flabellata Ridley | Ref. |
|
|
zoom in
| Organism | Dodonaea viscosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Erdtman,Tetrahedron (Suppl.7),8,(1966),71 |
|---|
|