| Name |
Luteolin 7-O-beta-D-glucuronide Luteolin 7-O-glucuronide Luteolin 7-glucuronide |
| Formula |
C21H18O12 |
| Mw |
462.07982604 |
| CAS RN |
29741-10-4 |
| C_ID |
C00004268
, 
|
| InChIKey |
VSUOKLTVXQRUSG-GGNWGOABNA-N |
| InChICode |
InChI=1S/C21H18O12/c22-9-2-1-7(3-10(9)23)13-6-12(25)15-11(24)4-8(5-14(15)32-13)31-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-6,16-19,21-24,26-28H,(H,29,30)/t16-,17-,18+,19-,21+/m0/s1 |
| SMILES |
O=C(O)C1O[C@@H](Oc2cc(O)c3c(=O)cc(-c4ccc(O)c(O)c4)oc3c2)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Acanthus ebracteatus | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Asteraceae | Lactuca indica  | Ref. |
| Plantae | Asteraceae | Leontodon autumnalis | Ref. |
| Plantae | Asteraceae | Santolina chamaecyperissus | Ref. |
| Plantae | Asteraceae | Tanacetum parthenium (L.) Schulz Bip.  | Ref. |
| Plantae | Fabaceae | Medicago arabica | Ref. |
| Plantae | Fabaceae | Medicago polymorpha  | Ref. |
| Plantae | Fabaceae | Medicago radiata | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Salvia palaestina | Ref. |
| Plantae | Labiatae | Salvia pratensis  | Ref. |
| Plantae | Labiatae | Salvia triloba  | Ref. |
| Plantae | Labiatae | Stachys alopecuros (L.) Benth. | Ref. |
| Plantae | Labiatae | Stachys officinalis (L.) Trev.  | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Labiatae | Tripora divaricata | Ref. |
| Plantae | Marchantiaceae | Marchantia polymorpha | Ref. |
| Plantae | Onagraceae | Fuchsia excorticata  | Ref. |
| Plantae | Onagraceae | Fuchsia procumbens | Ref. |
| Plantae | Orobanchaceae | Pedicularis longiflora var. tubiformis | Ref. |
| Plantae | Plantaginaceae | Antirrhinum majus  | Ref. |
| Plantae | Plantaginaceae | Picria fel-terrae  | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Veronica spuria | Ref. |
| Plantae | Ricciaceae | Riccia fluitans L | Ref. |
| Plantae | Scrophulariaceae | Hebe parviflora | Ref. |
| Plantae | Verbenaceae | Lippia alba  | Ref. |
| - | - | Sphaerocarpos texanus | Ref. |
|
|
zoom in
| Organism | Antirrhinum majus | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Harborne,Phytochem.,2,(1963),327 |
|---|
|