| Name |
5-Hydroxy-7,3',4'-trimethoxyflavone Luteolin 7,3',4'-trimethyl ether 2-(3,4-Dimethoxyphenyl)-5-hydroxy-7-methoxy-4H-1-benzopyran-4-one |
| Formula |
C18H16O6 |
| Mw |
328.09468824 |
| CAS RN |
29080-58-8 |
| C_ID |
C00003870
, 
|
| InChIKey |
HIXDQWDOVZUNNA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O6/c1-21-11-7-12(19)18-13(20)9-15(24-17(18)8-11)10-4-5-14(22-2)16(6-10)23-3/h4-9,19H,1-3H3 |
| SMILES |
COc1cc(O)c2c(=O)cc(-c3ccc(OC)c(OC)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Arnica spp. | Ref. |
| Plantae | Asteraceae | Baccharis trinervis  | Ref. |
| Plantae | Asteraceae | Calea ternifolia | Ref. |
| Plantae | Asteraceae | Lychnophora affinis | Ref. |
| Plantae | Boraginaceae | Nonea pulla | Ref. |
| Plantae | Celastraceae | Hippocratea mucronata | Ref. |
| Plantae | Cunoniaceae | Eucryphia lucida | Ref. |
| Plantae | Cunoniaceae | Eucryphia milliganii | Ref. |
| Plantae | Fabaceae | Ononis spinosa  | Ref. |
| Plantae | Labiatae | Leucas cephalotes SPRENG.  | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Labiatae | Salvia aegyptiaca  | Ref. |
| Plantae | Labiatae | Salvia aethiopis | Ref. |
| Plantae | Labiatae | Salvia euphratica | Ref. |
| Plantae | Labiatae | Salvia virgata | Ref. |
| Plantae | Labiatae | Sideritis spp. | Ref. |
| Plantae | Labiatae | Teucrium botrys | Ref. |
| Plantae | Malvaceae | Kitaibelia vitifolia | Ref. |
| Plantae | Orobanchaceae | Striga asiatica  | Ref. |
| Plantae | Piperaceae | Piper peepuloides | Ref. |
| Plantae | Piperaceae | Piper sylvaticum Roxb.  | Ref. |
| Plantae | Plantaginaceae | Anarrhinum forskahlii | Ref. |
| Plantae | Plantaginaceae | Anarrhinum spp. | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Thymelaeaceae | Lethedon tannaensis  | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| Plantae | Verbenaceae | Lantana montevidensis | Ref. |
| Plantae | Zingiberaceae | Kaempferia parviflora  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Turnera diffusa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Dhar,Planta Med.,18,(1970),332
Le Quesne,Lloydia,39,(1976),391 |
|---|
|