| Name |
5,4'-Dihydroxy-6,7-dimethoxyflavone
Circimaritin
Cirsimaritin |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
6601-62-3 |
| C_ID |
C00003837
, 
|
| InChIKey |
ZIIAJIWLQUVGHB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-14-8-13-15(16(20)17(14)22-2)11(19)7-12(23-13)9-3-5-10(18)6-4-9/h3-8,18,20H,1-2H3 |
| SMILES |
COc1cc2oc(-c3ccc(O)cc3)cc(=O)c2c(O)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia capillaris | Ref. |
| Plantae | Asteraceae | Artemisia scoparia. | Ref. |
| Plantae | Asteraceae | Artemisia vestita | Ref. |
| Plantae | Asteraceae | Baccharis eleagnoides | Ref. |
| Plantae | Asteraceae | Brickellia californica | Ref. |
| Plantae | Asteraceae | Cirsium brevistylum | Ref. |
| Plantae | Fabaceae | Ononis vaginalis | Ref. |
| Plantae | Labiatae | Origanum akhadarense | Ref. |
| Plantae | Labiatae | Origanum akhadarensis | Ref. |
| Plantae | Labiatae | Origanum boissieri | Ref. |
| Plantae | Labiatae | Origanum hypercifolium | Ref. |
| Plantae | Labiatae | Origanum micranthum | Ref. |
| Plantae | Labiatae | Origanum vulgare | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus | Ref. |
| Plantae | Labiatae | Plectranthus ecklonii Benth. | Ref. |
| Plantae | Labiatae | Plectranthus fruticosus | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis | Ref. |
| Plantae | Labiatae | Salvia columbariae | Ref. |
| Plantae | Labiatae | Salvia dorrii | Ref. |
| Plantae | Labiatae | Salvia lavandulaefolia | Ref. |
| Plantae | Labiatae | Salvia lavandulifolia | Ref. |
| Plantae | Labiatae | Salvia macrosiphon | Ref. |
| Plantae | Labiatae | Salvia mirzayana | Ref. |
| Plantae | Labiatae | Salvia nicolsoniana | Ref. |
| Plantae | Labiatae | Salvia officinalis | Ref. |
| Plantae | Labiatae | Salvia palaestina | Ref. |
| Plantae | Labiatae | Salvia sapinae | Ref. |
| Plantae | Labiatae | Salvia tomentosa | Ref. |
| Plantae | Labiatae | Salvia verbenaca | Ref. |
| Plantae | Labiatae | Teucrium polium | Ref. |
| Plantae | Labiatae | Teucrium ramosissimum | Ref. |
| Plantae | Labiatae | Thymus numidicus | Ref. |
| Plantae | Labiatae | Thymus vulgaris | Ref. |
| Plantae | Lamiaceae | Coleus aromaticus | Ref. |
| Plantae | Plantaginaceae | Digitalis thapsi | Ref. |
| Plantae | Pteridaceae | Cheilanthes argentea | Ref. |
| Plantae | Rutaceae | Citrus reticulata | Ref. |
| Plantae | Verbenaceae | Lippia dulcis TREV. | Ref. |
|
|
zoom in
| Organism | Salvia officinalis |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Brieskorn,Tetrahedron Lett.,(1969),2603
Wallace,Phytochem.,10,(1970),452 |
|---|
|
