| Name |
All-trans-squalene Squalene Spinacene Supraene trans-Squalene |
| Formula |
C30H50 |
| Mw |
410.39125159 |
| CAS RN |
111-02-4 |
| C_ID |
C00003755
, 
|
| InChIKey |
YYGNTYWPHWGJRM-AAJYLUCBSA-N |
| InChICode |
InChI=1S/C30H50/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4/h15-18,23-24H,9-14,19-22H2,1-8H3/b27-17+,28-18+,29-23+,30-24+ |
| SMILES |
CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(C)CC/C=C(C)CCC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Polyporaceae | Fomes officinalis | Ref. |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Alliaceae | Allium Sativum | Ref. |
| Plantae | Aquifoliaceae | Ilex asprella | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia vulgaris  | Ref. |
| Plantae | Asteraceae | Baccharis spp. | Ref. |
| Plantae | Asteraceae | Doellingeria scaber | Ref. |
| Plantae | Asteraceae | Eriocephalus scariosus | Ref. |
| Plantae | Asteraceae | Microglossa zeylandica | Ref. |
| Plantae | Asteraceae | Nidorella auriculata | Ref. |
| Plantae | Cannabaceae | Cannabis inflorescences | Ref. |
| Plantae | Celastraceae | Tripterygium wilfordii  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia multiflora  | Ref. |
| Plantae | Combretaceae | Terminalia brasiliensis | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cucurbitaceae | Cucurbita sp.  | Ref. |
| Plantae | Cucurbitaceae | Luffa cylindrica  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Cyatheaceae | Cyathea podophylla | Ref. |
| Plantae | Euphorbiaceae | Aleurites cordata | Ref. |
| Plantae | Euphorbiaceae | Neoboutonia glabrescens Prain | Ref. |
| Plantae | Fabaceae | Abrus precatorius  | Ref. |
| Plantae | Fabaceae | Acacia pennatula | Ref. |
| Plantae | Fabaceae | Caesalpinia decapetala  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Mucuna puriens | Ref. |
| Plantae | Gentianaceae | Gentiana lutea L.  | Ref. |
| Plantae | Gentianaceae | Gentiana straminea  | Ref. |
| Plantae | Hydrangeaceae | Hydrangea chinensis | Ref. |
| Plantae | Labiatae | Callicarpa pilosissima | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia canariensis L. | Ref. |
| Plantae | Labiatae | Salvia miltiorrhiza  | Ref. |
| Plantae | Labiatae | Salvia splendens | Ref. |
| Plantae | Labiatae | Sideritis candicans var.eriocephala | Ref. |
| Plantae | Labiatae | Sideritis discolor | Ref. |
| Plantae | Labiatae | Sideritis lotsyi var. mascaensis | Ref. |
| Plantae | Labiatae | Sideritis soluta | Ref. |
| Plantae | Labiatae | Tectona grandis  | Ref. |
| Plantae | Lauraceae | Cinnamomum subavenium MIQ. | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Malvaceae | Tilia vulgaris | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Moraceae | Ficus septica | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendron  | Ref. |
| Plantae | Palmae | Sabal blackburniana | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Primulaceae | Primula ovalifolia | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Samydaceae | Casearia membranacea | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Zingiberaceae | Zingiber zerumbet  | Ref. |
| - | - | Gymnaster koraiensis | Ref. |
| - | - | Laurencia dendroidea | Ref. |
|
|
zoom in
| Organism | Acacia pennatula | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|