| Name |
allo-Aromadendrene L-Alloaromadendrene Alloaromadendrene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
25246-27-9 |
| C_ID |
C00021229
, 
|
| InChIKey |
ITYNGVSTWVVPIC-JQXIRTQVNA-N |
| InChICode |
InChI=1S/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h10-14H,1,5-8H2,2-4H3/t10-,11-,12-,13+,14-/m1/s1 |
| SMILES |
C=C1CC[C@@H]2[C@H]([C@@H]3[C@H](C)CC[C@H]13)C2(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona glabra  | Ref. |
| Plantae | Annonaceae | Cananga odorata  | Ref. |
| Plantae | Annonaceae | Xylopia sericea  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia trilobata  | Ref. |
| Plantae | Asteraceae | Petasites albus  | Ref. |
| Plantae | Asteraceae | Petasites hybridus  | Ref. |
| Plantae | Asteraceae | Phagnalon sordidum | Ref. |
| Plantae | Asteraceae | Santolina corsica Jordan et Fourr | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Cistaceae | Cistus albidus | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Cyperaceae | Cyperus rotundus L.  | Ref. |
| Plantae | Gymnomitriaceae | Marsupella emarginata | Ref. |
| Plantae | Jubulaceae | Frullania probosciphora | Ref. |
| Plantae | Labiatae | Cunila angustifolia | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Perovskia scrophulariaefolia | Ref. |
| Plantae | Labiatae | Satureja subspicata  | Ref. |
| Plantae | Labiatae | Thymus broussonetti | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus maroccanus | Ref. |
| Plantae | Labiatae | Thymus praecos | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
| Plantae | Lepidoziaceae | Lepidozia fauriana | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Meliaceae | Guarea macrophylla ssp.tuberculata | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Myrtaceae | Eucalyptus globulus  | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendra L.  | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendron  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Orchidaceae | Sarcophyton glaucum | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Primulaceae | Primula halleri | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis L.  | Ref. |
| Plantae | Rutaceae | Clausena excavata  | Ref. |
| Plantae | Rutaceae | Murraya exotica  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Scapaniaceae | Tritomaria quinquedentata (Huds.) | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Zingiberaceae | Curcuma amada  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Agatis moorei | Ref. |
|
|
zoom in
| Organism | Thymus maroccanus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|