| Name |
Adenosine |
| Formula |
C10H13N5O4 |
| Mw |
267.09675394 |
| CAS RN |
58-61-7 |
| C_ID |
C00007444
, 
|
| InChIKey |
OIRDTQYFTABQOQ-CDACIVGJNA-N |
| InChICode |
InChI=1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6-,7-,10+/m0/s1 |
| SMILES |
Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@H](O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Asp L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Plantae | Acanthaceae | Acanthus ebracteatus | Ref. |
| Plantae | Acanthaceae | Acanthus ilicifolius  | Ref. |
| Plantae | Alliaceae | Allium tuberosum Rottl.ex Spreng.  | Ref. |
| Plantae | Araliaceae | Acanthopanax giraldii | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asteraceae | Atractylodes lancea  | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis tangshen OLIV.  | Ref. |
| Plantae | Capparaceae | Capparis flavicans | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cucurbitaceae | Cucumis sativus L.  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea opposita  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Oxytropis myriophylla | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Lauraceae | Cassytha filiformis  | Ref. |
| Plantae | Liliaceae | Fritillaria cirrhosa  | Ref. |
| Plantae | Longaniaceae | Strychnos lucida | Ref. |
| Plantae | Menispermaceae | Tinospora crispa  | Ref. |
| Plantae | Orchidaceae | Gastrodia elata  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Poaceae | Zea mays L.  | Ref. |
| Plantae | Pteridaceae | Adiantum lunulatum  | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Rubiaceae | Coffea canephora  | Ref. |
| Plantae | Rutaceae | Citrus unshiu  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Datura metel  | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Junceella juncea | Ref. |
| - | - | Subergorgia suberosa | Ref. |
|
|
zoom in
| Organism | Tinospora crispa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|