| Name |
Puerarin Kakonein |
| Formula |
C21H20O9 |
| Mw |
416.11073224 |
| CAS RN |
3681-99-0 |
| C_ID |
C00006094
, 
|
| InChIKey |
HKEAFJYKMMKDOR-RJFRUACSNA-N |
| InChICode |
InChI=1S/C21H20O9/c22-7-14-17(26)18(27)19(28)21(30-14)15-13(24)6-5-11-16(25)12(8-29-20(11)15)9-1-3-10(23)4-2-9/h1-6,8,14,17-19,21-24,26-28H,7H2/t14-,17-,18+,19-,21+/m1/s1 |
| SMILES |
O=c1c(-c2ccc(O)cc2)coc2c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)ccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Bupleurum scorzonerifolium  | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus koreana | Ref. |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
| Plantae | Fabaceae | Cicer arietinum  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Psoralea corylifolia  | Ref. |
| Plantae | Fabaceae | Pterocarpus marsupium  | Ref. |
| Plantae | Fabaceae | Pueraria calycina | Ref. |
| Plantae | Fabaceae | Pueraria candollei var. mirifica | Ref. |
| Plantae | Fabaceae | Pueraria edulis | Ref. |
| Plantae | Fabaceae | Pueraria lobata  | Ref. |
| Plantae | Fabaceae | Pueraria lobata var.thomsonii  | Ref. |
| Plantae | Fabaceae | Pueraria mirifica  | Ref. |
| Plantae | Fabaceae | Pueraria montana var. lobata | Ref. |
| Plantae | Fabaceae | Pueraria omeiensis | Ref. |
| Plantae | Fabaceae | Pueraria peduncularis | Ref. |
| Plantae | Fabaceae | Pueraria phaseoloides  | Ref. |
| Plantae | Fabaceae | Pueraria thomsonii  | Ref. |
| Plantae | Fabaceae | Pueraria thunbergiana  | Ref. |
| Plantae | Fabaceae | Pueraria tuberosa  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Vigna radiata  | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| - | - | Sarcolobus globosus | Ref. |
|
|
zoom in
| Organism | Pueraria thunbergiana | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Murakami,Chem.Pharm.Bull.,8,(1960),688
Ingham,Phytochem.,25,(1986),1771 |
|---|
|