| Name |
Brassicasterol (24R)24-Methylcholest-5,22-dien-3beta-ol |
| Formula |
C28H46O |
| Mw |
398.35486609 |
| CAS RN |
474-67-9 |
| C_ID |
C00003646
, 
|
| InChIKey |
OILXMJHPFNGGTO-QHFAAILRNA-N |
| InChICode |
InChI=1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-9,18-20,22-26,29H,10-17H2,1-6H3/b8-7+/t19-,20-,22-,23-,24+,25-,26-,27-,28-/m0/s1 |
| SMILES |
CC(C)[C@@H](C)/C=C/[C@@H](C)[C@H]1CC[C@H]2C3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Arthrodermataceae | Trichophyton rubrum | Ref. |
| Fungi | Cladoniaceae | Cladonia gonecha | Ref. |
| Fungi | Clavicipitaceae | Claviceps fusiformis | Ref. |
| Fungi | Clavicipitaceae | Claviceps purpurea  | Ref. |
| Fungi | Gnomoniaceae | Gnomonia leptostyla | Ref. |
| Fungi | Protomycetaceae | Protomyces sp. | Ref. |
| Fungi | Stereocaulaceae | Stereocaulon tomentosum | Ref. |
| Fungi | Taphrinaceae | Taphrina sp. | Ref. |
| Fungi | Terfeziaceae/Pezizaceae | Terfezia sp. | Ref. |
| Fungi | Trichocomaceae | Aspergillus oryzae | Ref. |
| Plantae | Alliaceae | Allium obliquum  | Ref. |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica napus  | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cruciferae | Brassica rapa L.  | Ref. |
| Plantae | Plantaginaceae | Veronica officinalis  | Ref. |
| Plantae | Plantaginaceae | Veronica orchidea | Ref. |
| Plantae | Plantaginaceae | Veronica teucrium | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Sapindaceae | Schleichera trijuga  | Ref. |
| - | - | Chloromorum toxicum | Ref. |
| - | - | Chorisia insignis | Ref. |
| - | - | Chorisia speciosa | Ref. |
| - | - | Genera protomyces | Ref. |
| - | - | Tuber bramale | Ref. |
|
|
zoom in
| Organism | Genera protomyces | | Reference | Nes,Analysis of Sterols and Other Biologically Significant Steroids
Academic Press Inc.,New York,Ny,341 pp.(1989)
Turner,Fungal Metabolites II,Academic Press,New York,NY,631 pp.(1983) |
|---|
|