| Name |
Hesperetin |
| Formula |
C16H14O6 |
| Mw |
302.07903818 |
| CAS RN |
520-33-2 |
| C_ID |
C00000968
, 
|
| InChIKey |
AIONOLUJZLIMTK-YQTOOIBONA-N |
| InChICode |
InChI=1S/C16H14O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-6,14,17-19H,7H2,1H3/t14-/m0/s1 |
| SMILES |
COc1ccc([C@@H]2CC(=O)c3c(O)cc(O)cc3O2)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araceae | Anthurium spp. | Ref. |
| Plantae | Asteraceae | Brickellia vernicosa | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Isatis indigotica  | Ref. |
| Plantae | Fabaceae | Dalbergia parviflora  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Labiatae | Mentha aquatica L.  | Ref. |
| Plantae | Labiatae | Mentha spp.  | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Palmae | Cocos nucifera  | Ref. |
| Plantae | Rosaceae | Prunus persica  | Ref. |
| Plantae | Rutaceae | Citrus aurantium L. var. amara  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| Plantae | Verbenaceae | Verbena bipinnatifida | Ref. |
| Plantae | Verbenaceae | Verbena hybrida | Ref. |
| - | - | Mentha | Ref. |
|
|
zoom in
| Organism | Verbena bipinnatifida | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|